C30H26F2N4O4 — CID 14723865
benzyl (6E)-9,9-bis(4-fluorophenyl)-3-hydroxy-8-(1-methyltetrazol-5-yl)-5-oxonona-6,8-dienoate (PubChem CID 14723865) has the molecular formula C30H26F2N4O4 and a molecular weight of 544.56 g/mol. Its IUPAC name is benzyl (6E)-9,9-bis(4-fluorophenyl)-3-hydroxy-8-(1-methyltetrazol-5-yl)-5-oxonona-6,8-dienoate.
| Compound Name | benzyl (6E)-9,9-bis(4-fluorophenyl)-3-hydroxy-8-(1-methyltetrazol-5-yl)-5-oxonona-6,8-dienoate |
|---|---|
| PubChem CID | 14723865 |
| Molecular Formula | C30H26F2N4O4 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | benzyl (6E)-9,9-bis(4-fluorophenyl)-3-hydroxy-8-(1-methyltetrazol-5-yl)-5-oxonona-6,8-dienoate |
| SMILES | Cn1nnnc1C(/C=C/C(=O)CC(O)CC(=O)OCc1ccccc1)=C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H26F2N4O4/c1-36-30(33-34-35-36)27(29(21-7-11-23(31)12-8-21)22-9-13-24(32)14-10-22)16-15-25(37)17-26(38)18-28(39)40-19-20-5-3-2-4-6-20/h2-16,26,38H,17-19H2,1H3/b16-15+ |
| InChIKey | SEQILEFLWKNVMC-FOCLMDBBSA-N |
| XLogP | 4.46 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|