C23H24F2N4O5 — CID 88506736
(6E)-9,9-bis(2-fluorophenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoic acid;hydrate (PubChem CID 88506736) has the molecular formula C23H24F2N4O5 and a molecular weight of 474.46 g/mol. Its IUPAC name is (6E)-9,9-bis(2-fluorophenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoic acid;hydrate.
| Compound Name | (6E)-9,9-bis(2-fluorophenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoic acid;hydrate |
|---|---|
| PubChem CID | 88506736 |
| Molecular Formula | C23H24F2N4O5 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (6E)-9,9-bis(2-fluorophenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoic acid;hydrate |
| SMILES | Cn1nnnc1C(/C=C/C(O)CC(O)CC(=O)O)=C(c1ccccc1F)c1ccccc1F.O |
| InChI | InChI=1S/C23H22F2N4O4.H2O/c1-29-23(26-27-28-29)18(11-10-14(30)12-15(31)13-21(32)33)22(16-6-2-4-8-19(16)24)17-7-3-5-9-20(17)25;/h2-11,14-15,30-31H,12-13H2,1H3,(H,32,33);1H2/b11-10+; |
| InChIKey | NRTMGZIWJBMUCL-ASTDGNLGSA-N |
| XLogP | 1.77 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|