C16H19N3O4 — CID 54449637
3,5-dihydroxy-7-(3-methyl-5-phenyltriazol-4-yl)hept-6-enoic acid (PubChem CID 54449637) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3,5-dihydroxy-7-(3-methyl-5-phenyltriazol-4-yl)hept-6-enoic acid.
| Compound Name | 3,5-dihydroxy-7-(3-methyl-5-phenyltriazol-4-yl)hept-6-enoic acid |
|---|---|
| PubChem CID | 54449637 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3,5-dihydroxy-7-(3-methyl-5-phenyltriazol-4-yl)hept-6-enoic acid |
| SMILES | Cn1nnc(-c2ccccc2)c1C=CC(O)CC(O)CC(=O)O |
| InChI | InChI=1S/C16H19N3O4/c1-19-14(8-7-12(20)9-13(21)10-15(22)23)16(17-18-19)11-5-3-2-4-6-11/h2-8,12-13,20-21H,9-10H2,1H3,(H,22,23) |
| InChIKey | WTZYXFLMVKFGCD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |