C29H34F2N4O4 — CID 54260079
tert-butyl 9,9-bis(2-fluoro-4-methylphenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoate (PubChem CID 54260079) has the molecular formula C29H34F2N4O4 and a molecular weight of 540.61 g/mol. Its IUPAC name is tert-butyl 9,9-bis(2-fluoro-4-methylphenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoate.
| Compound Name | tert-butyl 9,9-bis(2-fluoro-4-methylphenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoate |
|---|---|
| PubChem CID | 54260079 |
| Molecular Formula | C29H34F2N4O4 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | tert-butyl 9,9-bis(2-fluoro-4-methylphenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoate |
| SMILES | Cc1ccc(C(=C(C=CC(O)CC(O)CC(=O)OC(C)(C)C)c2nnnn2C)c2ccc(C)cc2F)c(F)c1 |
| InChI | InChI=1S/C29H34F2N4O4/c1-17-7-10-21(24(30)13-17)27(22-11-8-18(2)14-25(22)31)23(28-32-33-34-35(28)6)12-9-19(36)15-20(37)16-26(38)39-29(3,4)5/h7-14,19-20,36-37H,15-16H2,1-6H3 |
| InChIKey | RCWOYGUJLXGCOP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|