C29H32F2N4O4 — CID 57147419
tert-butyl (5S)-9,9-bis(4-fluoro-2-methylphenyl)-5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxonona-6,8-dienoate (PubChem CID 57147419) has the molecular formula C29H32F2N4O4 and a molecular weight of 538.60 g/mol. Its IUPAC name is tert-butyl (5S)-9,9-bis(4-fluoro-2-methylphenyl)-5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxonona-6,8-dienoate.
| Compound Name | tert-butyl (5S)-9,9-bis(4-fluoro-2-methylphenyl)-5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxonona-6,8-dienoate |
|---|---|
| PubChem CID | 57147419 |
| Molecular Formula | C29H32F2N4O4 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | tert-butyl (5S)-9,9-bis(4-fluoro-2-methylphenyl)-5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxonona-6,8-dienoate |
| SMILES | Cc1cc(F)ccc1C(=C(C=C[C@@H](O)CC(=O)CC(=O)OC(C)(C)C)c1nnnn1C)c1ccc(F)cc1C |
| InChI | InChI=1S/C29H32F2N4O4/c1-17-13-19(30)7-10-23(17)27(24-11-8-20(31)14-18(24)2)25(28-32-33-34-35(28)6)12-9-21(36)15-22(37)16-26(38)39-29(3,4)5/h7-14,21,36H,15-16H2,1-6H3/t21-/m1/s1 |
| InChIKey | RKYLJJOCQFGJLV-OAQYLSRUSA-N |
| XLogP | 4.67 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|