C28H34FNO4 — CID 129449965
tert-butyl (Z,5S)-7-[(2S,3S)-3-(4-fluorophenyl)-1-propan-2-yl-2,3-dihydroindol-2-yl]-5-hydroxy-3-oxohept-6-enoate (PubChem CID 129449965) has the molecular formula C28H34FNO4 and a molecular weight of 467.58 g/mol. Its IUPAC name is tert-butyl (Z,5S)-7-[(2S,3S)-3-(4-fluorophenyl)-1-propan-2-yl-2,3-dihydroindol-2-yl]-5-hydroxy-3-oxohept-6-enoate.
| Compound Name | tert-butyl (Z,5S)-7-[(2S,3S)-3-(4-fluorophenyl)-1-propan-2-yl-2,3-dihydroindol-2-yl]-5-hydroxy-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 129449965 |
| Molecular Formula | C28H34FNO4 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | tert-butyl (Z,5S)-7-[(2S,3S)-3-(4-fluorophenyl)-1-propan-2-yl-2,3-dihydroindol-2-yl]-5-hydroxy-3-oxohept-6-enoate |
| SMILES | CC(C)N1c2ccccc2[C@H](c2ccc(F)cc2)[C@@H]1/C=C\[C@@H](O)CC(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H34FNO4/c1-18(2)30-24-9-7-6-8-23(24)27(19-10-12-20(29)13-11-19)25(30)15-14-21(31)16-22(32)17-26(33)34-28(3,4)5/h6-15,18,21,25,27,31H,16-17H2,1-5H3/b15-14-/t21-,25+,27+/m1/s1 |
| InChIKey | PTRLTBZGRUPTEG-JQBTWMMBSA-N |
| XLogP | 5.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|