C25H30FNO4 — CID 125462933
methyl (E,3R,5S)-7-[(2S,3S)-3-(4-fluorophenyl)-1-propan-2-yl-2,3-dihydroindol-2-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 125462933) has the molecular formula C25H30FNO4 and a molecular weight of 427.52 g/mol. Its IUPAC name is methyl (E,3R,5S)-7-[(2S,3S)-3-(4-fluorophenyl)-1-propan-2-yl-2,3-dihydroindol-2-yl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | methyl (E,3R,5S)-7-[(2S,3S)-3-(4-fluorophenyl)-1-propan-2-yl-2,3-dihydroindol-2-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 125462933 |
| Molecular Formula | C25H30FNO4 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | methyl (E,3R,5S)-7-[(2S,3S)-3-(4-fluorophenyl)-1-propan-2-yl-2,3-dihydroindol-2-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | COC(=O)C[C@H](O)C[C@H](O)/C=C/[C@H]1[C@@H](c2ccc(F)cc2)c2ccccc2N1C(C)C |
| InChI | InChI=1S/C25H30FNO4/c1-16(2)27-22-7-5-4-6-21(22)25(17-8-10-18(26)11-9-17)23(27)13-12-19(28)14-20(29)15-24(30)31-3/h4-13,16,19-20,23,25,28-29H,14-15H2,1-3H3/b13-12+/t19-,20-,23+,25+/m1/s1 |
| InChIKey | GJCKCAUVFZGLHH-GNCZUJLESA-N |
| XLogP | 3.79 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|