C34H33ClF2N2O5 — CID 91433109
methyl 7-[5-[chloro(phenyl)carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 91433109) has the molecular formula C34H33ClF2N2O5 and a molecular weight of 623.10 g/mol. Its IUPAC name is methyl 7-[5-[chloro(phenyl)carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | methyl 7-[5-[chloro(phenyl)carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 91433109 |
| Molecular Formula | C34H33ClF2N2O5 |
| Molecular Weight | 623.10 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | methyl 7-[5-[chloro(phenyl)carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | COC(=O)CC(O)CC(O)C=Cc1c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c(C(=O)N(Cl)c2ccccc2)n1C(C)C |
| InChI | InChI=1S/C34H33ClF2N2O5/c1-21(2)38-29(18-17-27(40)19-28(41)20-30(42)44-3)31(22-9-13-24(36)14-10-22)32(23-11-15-25(37)16-12-23)33(38)34(43)39(35)26-7-5-4-6-8-26/h4-18,21,27-28,40-41H,19-20H2,1-3H3 |
| InChIKey | CHNGGFGTEPXSNF-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.10 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|