C33H33ClF2N2O5 — CID 90690139
7-[5-[chloro(phenyl)carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 90690139) has the molecular formula C33H33ClF2N2O5 and a molecular weight of 611.09 g/mol. Its IUPAC name is 7-[5-[chloro(phenyl)carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | 7-[5-[chloro(phenyl)carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 90690139 |
| Molecular Formula | C33H33ClF2N2O5 |
| Molecular Weight | 611.09 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 7-[5-[chloro(phenyl)carbamoyl]-3,4-bis(4-fluorophenyl)-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CC(C)n1c(CCC(O)CC(O)CC(=O)O)c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c1C(=O)N(Cl)c1ccccc1 |
| InChI | InChI=1S/C33H33ClF2N2O5/c1-20(2)37-28(17-16-26(39)18-27(40)19-29(41)42)30(21-8-12-23(35)13-9-21)31(22-10-14-24(36)15-11-22)32(37)33(43)38(34)25-6-4-3-5-7-25/h3-15,20,26-27,39-40H,16-19H2,1-2H3,(H,41,42) |
| InChIKey | AXRKDZWCMAUUAS-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.09 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|