C35H39FN2O6 — CID 91008206
7-[5-[benzyl(methoxy)carbamoyl]-3-(4-fluorophenyl)-4-phenyl-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 91008206) has the molecular formula C35H39FN2O6 and a molecular weight of 602.70 g/mol. Its IUPAC name is 7-[5-[benzyl(methoxy)carbamoyl]-3-(4-fluorophenyl)-4-phenyl-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | 7-[5-[benzyl(methoxy)carbamoyl]-3-(4-fluorophenyl)-4-phenyl-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 91008206 |
| Molecular Formula | C35H39FN2O6 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 7-[5-[benzyl(methoxy)carbamoyl]-3-(4-fluorophenyl)-4-phenyl-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | CON(Cc1ccccc1)C(=O)c1c(-c2ccccc2)c(-c2ccc(F)cc2)c(CCC(O)CC(O)CC(=O)O)n1C(C)C |
| InChI | InChI=1S/C35H39FN2O6/c1-23(2)38-30(19-18-28(39)20-29(40)21-31(41)42)32(26-14-16-27(36)17-15-26)33(25-12-8-5-9-13-25)34(38)35(43)37(44-3)22-24-10-6-4-7-11-24/h4-17,23,28-29,39-40H,18-22H2,1-3H3,(H,41,42) |
| InChIKey | NKOTZPLBNWDWGX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|