C40H39F2N2NaO6 — CID 173213741
sodium;(3R,5S)-7-[3,4-bis(4-fluorophenyl)-5-[phenyl(phenylmethoxy)carbamoyl]-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoic acid;hydride (PubChem CID 173213741) has the molecular formula C40H39F2N2NaO6 and a molecular weight of 704.75 g/mol. Its IUPAC name is sodium;(3R,5S)-7-[3,4-bis(4-fluorophenyl)-5-[phenyl(phenylmethoxy)carbamoyl]-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoic acid;hydride.
| Compound Name | sodium;(3R,5S)-7-[3,4-bis(4-fluorophenyl)-5-[phenyl(phenylmethoxy)carbamoyl]-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoic acid;hydride |
|---|---|
| PubChem CID | 173213741 |
| Molecular Formula | C40H39F2N2NaO6 |
| Molecular Weight | 704.75 g/mol |
| Exact Mass | 704.27 |
| IUPAC Name | sodium;(3R,5S)-7-[3,4-bis(4-fluorophenyl)-5-[phenyl(phenylmethoxy)carbamoyl]-1-propan-2-ylpyrrol-2-yl]-3,5-dihydroxyhept-6-enoic acid;hydride |
| SMILES | CC(C)n1c(C=C[C@@H](O)C[C@@H](O)CC(=O)O)c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c1C(=O)N(OCc1ccccc1)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C40H38F2N2O6.Na.H/c1-26(2)43-35(22-21-33(45)23-34(46)24-36(47)48)37(28-13-17-30(41)18-14-28)38(29-15-19-31(42)20-16-29)39(43)40(49)44(32-11-7-4-8-12-32)50-25-27-9-5-3-6-10-27;;/h3-22,26,33-34,45-46H,23-25H2,1-2H3,(H,47,48);;/q;+1;-1/t33-,34-;;/m1../s1 |
| InChIKey | SIUPRGPYTUOKGD-LRKCTVFQSA-N |
| XLogP | 5.18 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.75 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|