C24H23FN2O5 — CID 14459258
methyl (E)-7-[5-(4-fluorophenyl)-3-methyl-2-oxo-1-phenylimidazol-4-yl]-5-hydroxy-3-oxohept-6-enoate (PubChem CID 14459258) has the molecular formula C24H23FN2O5 and a molecular weight of 438.46 g/mol. Its IUPAC name is methyl (E)-7-[5-(4-fluorophenyl)-3-methyl-2-oxo-1-phenylimidazol-4-yl]-5-hydroxy-3-oxohept-6-enoate.
| Compound Name | methyl (E)-7-[5-(4-fluorophenyl)-3-methyl-2-oxo-1-phenylimidazol-4-yl]-5-hydroxy-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 14459258 |
| Molecular Formula | C24H23FN2O5 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | methyl (E)-7-[5-(4-fluorophenyl)-3-methyl-2-oxo-1-phenylimidazol-4-yl]-5-hydroxy-3-oxohept-6-enoate |
| SMILES | COC(=O)CC(=O)CC(O)/C=C/c1c(-c2ccc(F)cc2)n(-c2ccccc2)c(=O)n1C |
| InChI | InChI=1S/C24H23FN2O5/c1-26-21(13-12-19(28)14-20(29)15-22(30)32-2)23(16-8-10-17(25)11-9-16)27(24(26)31)18-6-4-3-5-7-18/h3-13,19,28H,14-15H2,1-2H3/b13-12+ |
| InChIKey | BXAHOLIANAXEEQ-OUKQBFOZSA-N |
| XLogP | 2.88 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|