C24H30FNO6S — CID 67751615
methyl 7-[1-ethylsulfonyl-4-(4-fluorophenyl)-5-methyl-2-propan-2-ylpyrrol-3-yl]-5-hydroxy-3-oxohept-6-enoate (PubChem CID 67751615) has the molecular formula C24H30FNO6S and a molecular weight of 479.57 g/mol. Its IUPAC name is methyl 7-[1-ethylsulfonyl-4-(4-fluorophenyl)-5-methyl-2-propan-2-ylpyrrol-3-yl]-5-hydroxy-3-oxohept-6-enoate.
| Compound Name | methyl 7-[1-ethylsulfonyl-4-(4-fluorophenyl)-5-methyl-2-propan-2-ylpyrrol-3-yl]-5-hydroxy-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 67751615 |
| Molecular Formula | C24H30FNO6S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | methyl 7-[1-ethylsulfonyl-4-(4-fluorophenyl)-5-methyl-2-propan-2-ylpyrrol-3-yl]-5-hydroxy-3-oxohept-6-enoate |
| SMILES | CCS(=O)(=O)n1c(C)c(-c2ccc(F)cc2)c(C=CC(O)CC(=O)CC(=O)OC)c1C(C)C |
| InChI | InChI=1S/C24H30FNO6S/c1-6-33(30,31)26-16(4)23(17-7-9-18(25)10-8-17)21(24(26)15(2)3)12-11-19(27)13-20(28)14-22(29)32-5/h7-12,15,19,27H,6,13-14H2,1-5H3 |
| InChIKey | CCAASEYOAOVLBR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|