C26H26F2N2O4 — CID 14849791
methyl (E,5S)-7-[4,5-bis(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-5-hydroxy-3-oxohept-6-enoate (PubChem CID 14849791) has the molecular formula C26H26F2N2O4 and a molecular weight of 468.50 g/mol. Its IUPAC name is methyl (E,5S)-7-[4,5-bis(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-5-hydroxy-3-oxohept-6-enoate.
| Compound Name | methyl (E,5S)-7-[4,5-bis(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-5-hydroxy-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 14849791 |
| Molecular Formula | C26H26F2N2O4 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | methyl (E,5S)-7-[4,5-bis(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-5-hydroxy-3-oxohept-6-enoate |
| SMILES | COC(=O)CC(=O)C[C@H](O)/C=C/n1c(C(C)C)nc(-c2ccc(F)cc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H26F2N2O4/c1-16(2)26-29-24(17-4-8-19(27)9-5-17)25(18-6-10-20(28)11-7-18)30(26)13-12-21(31)14-22(32)15-23(33)34-3/h4-13,16,21,31H,14-15H2,1-3H3/b13-12+/t21-/m1/s1 |
| InChIKey | MDMAPFAOGSTGAH-JNCYCUAHSA-N |
| XLogP | 4.97 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|