C24H32FNO6S — CID 19889903
ethyl (E)-7-[4-(4-fluorophenyl)-5-methyl-1-methylsulfonyl-2-propan-2-ylpyrrol-3-yl]-2,2-dihydroxyhept-6-enoate (PubChem CID 19889903) has the molecular formula C24H32FNO6S and a molecular weight of 481.59 g/mol. Its IUPAC name is ethyl (E)-7-[4-(4-fluorophenyl)-5-methyl-1-methylsulfonyl-2-propan-2-ylpyrrol-3-yl]-2,2-dihydroxyhept-6-enoate.
| Compound Name | ethyl (E)-7-[4-(4-fluorophenyl)-5-methyl-1-methylsulfonyl-2-propan-2-ylpyrrol-3-yl]-2,2-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 19889903 |
| Molecular Formula | C24H32FNO6S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | ethyl (E)-7-[4-(4-fluorophenyl)-5-methyl-1-methylsulfonyl-2-propan-2-ylpyrrol-3-yl]-2,2-dihydroxyhept-6-enoate |
| SMILES | CCOC(=O)C(O)(O)CCC/C=C/c1c(-c2ccc(F)cc2)c(C)n(S(C)(=O)=O)c1C(C)C |
| InChI | InChI=1S/C24H32FNO6S/c1-6-32-23(27)24(28,29)15-9-7-8-10-20-21(18-11-13-19(25)14-12-18)17(4)26(33(5,30)31)22(20)16(2)3/h8,10-14,16,28-29H,6-7,9,15H2,1-5H3/b10-8+ |
| InChIKey | KOMFLGKZVAQHJV-CSKARUKUSA-N |
| XLogP | 3.96 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|