C28H32FNO6S — CID 19889910
ethyl (E)-7-[1-(benzenesulfonyl)-2-(4-fluorophenyl)-4-propan-2-ylpyrrol-3-yl]-2,2-dihydroxyhept-6-enoate (PubChem CID 19889910) has the molecular formula C28H32FNO6S and a molecular weight of 529.63 g/mol. Its IUPAC name is ethyl (E)-7-[1-(benzenesulfonyl)-2-(4-fluorophenyl)-4-propan-2-ylpyrrol-3-yl]-2,2-dihydroxyhept-6-enoate.
| Compound Name | ethyl (E)-7-[1-(benzenesulfonyl)-2-(4-fluorophenyl)-4-propan-2-ylpyrrol-3-yl]-2,2-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 19889910 |
| Molecular Formula | C28H32FNO6S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | ethyl (E)-7-[1-(benzenesulfonyl)-2-(4-fluorophenyl)-4-propan-2-ylpyrrol-3-yl]-2,2-dihydroxyhept-6-enoate |
| SMILES | CCOC(=O)C(O)(O)CCC/C=C/c1c(C(C)C)cn(S(=O)(=O)c2ccccc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H32FNO6S/c1-4-36-27(31)28(32,33)18-10-6-9-13-24-25(20(2)3)19-30(26(24)21-14-16-22(29)17-15-21)37(34,35)23-11-7-5-8-12-23/h5,7-9,11-17,19-20,32-33H,4,6,10,18H2,1-3H3/b13-9+ |
| InChIKey | VDBRANVZPAPYOV-UKTHLTGXSA-N |
| XLogP | 5.08 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|