C22H28FN3O6S — CID 74057344
7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-2,2-dihydroxyhept-6-enoic acid (PubChem CID 74057344) has the molecular formula C22H28FN3O6S and a molecular weight of 481.55 g/mol. Its IUPAC name is 7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-2,2-dihydroxyhept-6-enoic acid.
| Compound Name | 7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-2,2-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 74057344 |
| Molecular Formula | C22H28FN3O6S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-2,2-dihydroxyhept-6-enoic acid |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1C=CCCCC(O)(O)C(=O)O |
| InChI | InChI=1S/C22H28FN3O6S/c1-14(2)18-17(8-6-5-7-13-22(29,30)20(27)28)19(15-9-11-16(23)12-10-15)25-21(24-18)26(3)33(4,31)32/h6,8-12,14,29-30H,5,7,13H2,1-4H3,(H,27,28) |
| InChIKey | IENQKDKRRBKXPK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|