C35H37FN2O4 — CID 134950356
ethyl (E,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxyhept-3-enoate (PubChem CID 134950356) has the molecular formula C35H37FN2O4 and a molecular weight of 568.69 g/mol. Its IUPAC name is ethyl (E,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxyhept-3-enoate.
| Compound Name | ethyl (E,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxyhept-3-enoate |
|---|---|
| PubChem CID | 134950356 |
| Molecular Formula | C35H37FN2O4 |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | ethyl (E,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxyhept-3-enoate |
| SMILES | CCOC(=O)C/C=C/[C@H](O)CCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)Nc2ccccc2)c1C(C)C |
| InChI | InChI=1S/C35H37FN2O4/c1-4-42-30(40)17-11-16-29(39)22-23-38-33(24(2)3)32(35(41)37-28-14-9-6-10-15-28)31(25-12-7-5-8-13-25)34(38)26-18-20-27(36)21-19-26/h5-16,18-21,24,29,39H,4,17,22-23H2,1-3H3,(H,37,41)/b16-11+/t29-/m0/s1 |
| InChIKey | YMZCNDCERNXLOR-GCSXDFHUSA-N |
| XLogP | 7.60 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|