C66H66CaF2N4O8 — CID 172641355
Atorva statin calcium EP Impurity J (PubChem CID 172641355) has the molecular formula C66H66CaF2N4O8 and a molecular weight of 1121.35 g/mol.
| Compound Name | Atorva statin calcium EP Impurity J |
|---|---|
| PubChem CID | 172641355 |
| Molecular Formula | C66H66CaF2N4O8 |
| Molecular Weight | 1121.35 g/mol |
| Exact Mass | 1120.45 |
| IUPAC Name | — |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C/C=C/C(=O)O.CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C/C=C/C(=O)O.[Ca] |
| InChI | InChI=1S/2C33H33FN2O4.Ca/c2*1-22(2)31-30(33(40)35-26-12-7-4-8-13-26)29(23-10-5-3-6-11-23)32(24-16-18-25(34)19-17-24)36(31)21-20-27(37)14-9-15-28(38)39;/h2*3-13,15-19,22,27,37H,14,20-21H2,1-2H3,(H,35,40)(H,38,39);/b2*15-9+;/t2*27-;/m00./s1 |
| InChIKey | RNCWCVGZZKWNAN-RRFWMCJYSA-N |
| XLogP | 13.86 |
| TPSA | 183.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.35 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|