C33H33FN2O6 — CID 87481680
(3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxy-2-oxoheptanoic acid (PubChem CID 87481680) has the molecular formula C33H33FN2O6 and a molecular weight of 572.63 g/mol. Its IUPAC name is (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxy-2-oxoheptanoic acid.
| Compound Name | (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxy-2-oxoheptanoic acid |
|---|---|
| PubChem CID | 87481680 |
| Molecular Formula | C33H33FN2O6 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxy-2-oxoheptanoic acid |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)C(=O)C(=O)O |
| InChI | InChI=1S/C33H33FN2O6/c1-20(2)29-28(32(40)35-24-11-7-4-8-12-24)27(21-9-5-3-6-10-21)30(22-13-15-23(34)16-14-22)36(29)18-17-25(37)19-26(38)31(39)33(41)42/h3-16,20,25-26,37-38H,17-19H2,1-2H3,(H,35,40)(H,41,42)/t25-,26-/m1/s1 |
| InChIKey | OHLKBOGNZLWYCD-CLJLJLNGSA-N |
| XLogP | 5.49 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|