C34H39FN2O5 — CID 142058881
5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1-[(3R)-3,5,8,8-tetrahydroxyoctyl]pyrrole-3-carboxamide (PubChem CID 142058881) has the molecular formula C34H39FN2O5 and a molecular weight of 574.69 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1-[(3R)-3,5,8,8-tetrahydroxyoctyl]pyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1-[(3R)-3,5,8,8-tetrahydroxyoctyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 142058881 |
| Molecular Formula | C34H39FN2O5 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-yl-1-[(3R)-3,5,8,8-tetrahydroxyoctyl]pyrrole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)CC(O)CCC(O)O |
| InChI | InChI=1S/C34H39FN2O5/c1-22(2)32-31(34(42)36-26-11-7-4-8-12-26)30(23-9-5-3-6-10-23)33(24-13-15-25(35)16-14-24)37(32)20-19-28(39)21-27(38)17-18-29(40)41/h3-16,22,27-29,38-41H,17-21H2,1-2H3,(H,36,42)/t27?,28-/m1/s1 |
| InChIKey | GVMXVHPVCIGTGS-PLYLYKGUSA-N |
| XLogP | 5.93 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|