C35H36F4N2O7 — CID 75204412
(3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 75204412) has the molecular formula C35H36F4N2O7 and a molecular weight of 672.67 g/mol. Its IUPAC name is (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 75204412 |
| Molecular Formula | C35H36F4N2O7 |
| Molecular Weight | 672.67 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H35FN2O5.C2HF3O2/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;3-2(4,5)1(6)7/h3-16,21,26-27,37-38H,17-20H2,1-2H3,(H,35,41)(H,39,40);(H,6,7)/t26-,27-;/m1./s1 |
| InChIKey | WLFGKALBHCLXIQ-CNZCJKERSA-N |
| XLogP | 6.95 |
| TPSA | 149.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.67 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |