C31H30F2N2O3 — CID 102533789
1-[(3R,4R)-4-fluoro-3-hydroxy-5-oxopentyl]-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 102533789) has the molecular formula C31H30F2N2O3 and a molecular weight of 516.59 g/mol. Its IUPAC name is 1-[(3R,4R)-4-fluoro-3-hydroxy-5-oxopentyl]-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 1-[(3R,4R)-4-fluoro-3-hydroxy-5-oxopentyl]-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 102533789 |
| Molecular Formula | C31H30F2N2O3 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 1-[(3R,4R)-4-fluoro-3-hydroxy-5-oxopentyl]-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)[C@@H](F)C=O |
| InChI | InChI=1S/C31H30F2N2O3/c1-20(2)29-28(31(38)34-24-11-7-4-8-12-24)27(21-9-5-3-6-10-21)30(22-13-15-23(32)16-14-22)35(29)18-17-26(37)25(33)19-36/h3-16,19-20,25-26,37H,17-18H2,1-2H3,(H,34,38)/t25-,26+/m0/s1 |
| InChIKey | JBHVEIDWJSUVJT-IZZNHLLZSA-N |
| XLogP | 6.62 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|