C31H33FN2O — CID 16751805
5-(4-fluorophenyl)-1-pentyl-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 16751805) has the molecular formula C31H33FN2O and a molecular weight of 468.62 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-pentyl-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-1-pentyl-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 16751805 |
| Molecular Formula | C31H33FN2O |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 5-(4-fluorophenyl)-1-pentyl-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | CCCCCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)Nc2ccccc2)c1C(C)C |
| InChI | InChI=1S/C31H33FN2O/c1-4-5-12-21-34-29(22(2)3)28(31(35)33-26-15-10-7-11-16-26)27(23-13-8-6-9-14-23)30(34)24-17-19-25(32)20-18-24/h6-11,13-20,22H,4-5,12,21H2,1-3H3,(H,33,35) |
| InChIKey | YBGJDADCFQRSIC-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|