C30H32FN3O — CID 11956447
1-(4-aminobutyl)-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 11956447) has the molecular formula C30H32FN3O and a molecular weight of 469.60 g/mol. Its IUPAC name is 1-(4-aminobutyl)-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 1-(4-aminobutyl)-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 11956447 |
| Molecular Formula | C30H32FN3O |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 1-(4-aminobutyl)-5-(4-fluorophenyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCCCN |
| InChI | InChI=1S/C30H32FN3O/c1-21(2)28-27(30(35)33-25-13-7-4-8-14-25)26(22-11-5-3-6-12-22)29(34(28)20-10-9-19-32)23-15-17-24(31)18-16-23/h3-8,11-18,21H,9-10,19-20,32H2,1-2H3,(H,33,35) |
| InChIKey | IXRSUUGDVINMPV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|