C37H42FN2O5- — CID 86643743
3-tert-butyl-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-2,2-dihydroxyheptanoate (PubChem CID 86643743) has the molecular formula C37H42FN2O5- and a molecular weight of 613.75 g/mol. Its IUPAC name is 3-tert-butyl-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-2,2-dihydroxyheptanoate.
| Compound Name | 3-tert-butyl-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-2,2-dihydroxyheptanoate |
|---|---|
| PubChem CID | 86643743 |
| Molecular Formula | C37H42FN2O5- |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.31 |
| IUPAC Name | 3-tert-butyl-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-2,2-dihydroxyheptanoate |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCCCC(C(C)(C)C)C(O)(O)C(=O)[O-] |
| InChI | InChI=1S/C37H43FN2O5/c1-24(2)32-31(34(41)39-28-16-10-7-11-17-28)30(25-14-8-6-9-15-25)33(26-19-21-27(38)22-20-26)40(32)23-13-12-18-29(36(3,4)5)37(44,45)35(42)43/h6-11,14-17,19-22,24,29,44-45H,12-13,18,23H2,1-5H3,(H,39,41)(H,42,43)/p-1 |
| InChIKey | WDJKOCQVYWGHMK-UHFFFAOYSA-M |
| XLogP | 6.60 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|