C34H37FN2O4 — CID 122531815
(3R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-methoxyheptanoic acid (PubChem CID 122531815) has the molecular formula C34H37FN2O4 and a molecular weight of 556.68 g/mol. Its IUPAC name is (3R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-methoxyheptanoic acid.
| Compound Name | (3R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-methoxyheptanoic acid |
|---|---|
| PubChem CID | 122531815 |
| Molecular Formula | C34H37FN2O4 |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | (3R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-methoxyheptanoic acid |
| SMILES | CO[C@H](CCCCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)Nc2ccccc2)c1C(C)C)CC(=O)O |
| InChI | InChI=1S/C34H37FN2O4/c1-23(2)32-31(34(40)36-27-14-8-5-9-15-27)30(24-12-6-4-7-13-24)33(25-17-19-26(35)20-18-25)37(32)21-11-10-16-28(41-3)22-29(38)39/h4-9,12-15,17-20,23,28H,10-11,16,21-22H2,1-3H3,(H,36,40)(H,38,39)/t28-/m1/s1 |
| InChIKey | KZJVHFKSWHAAMP-MUUNZHRXSA-N |
| XLogP | 8.00 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|