C32H31FN2O2 — CID 58708288
5-(4-fluorophenyl)-1-(3-oxohex-5-enyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 58708288) has the molecular formula C32H31FN2O2 and a molecular weight of 494.61 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-(3-oxohex-5-enyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-1-(3-oxohex-5-enyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58708288 |
| Molecular Formula | C32H31FN2O2 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 5-(4-fluorophenyl)-1-(3-oxohex-5-enyl)-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | C=CCC(=O)CCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)Nc2ccccc2)c1C(C)C |
| InChI | InChI=1S/C32H31FN2O2/c1-4-11-27(36)20-21-35-30(22(2)3)29(32(37)34-26-14-9-6-10-15-26)28(23-12-7-5-8-13-23)31(35)24-16-18-25(33)19-17-24/h4-10,12-19,22H,1,11,20-21H2,2-3H3,(H,34,37) |
| InChIKey | SFTXAXXCQBVXEP-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|