C36H37FN2O3 — CID 158305812
[(3S)-1-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]hex-5-en-3-yl] but-2-enoate (PubChem CID 158305812) has the molecular formula C36H37FN2O3 and a molecular weight of 564.70 g/mol. Its IUPAC name is [(3S)-1-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]hex-5-en-3-yl] but-2-enoate.
| Compound Name | [(3S)-1-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]hex-5-en-3-yl] but-2-enoate |
|---|---|
| PubChem CID | 158305812 |
| Molecular Formula | C36H37FN2O3 |
| Molecular Weight | 564.70 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | [(3S)-1-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]hex-5-en-3-yl] but-2-enoate |
| SMILES | C=CC[C@@H](CCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)Nc2ccccc2)c1C(C)C)OC(=O)C=CC |
| InChI | InChI=1S/C36H37FN2O3/c1-5-13-30(42-31(40)14-6-2)23-24-39-34(25(3)4)33(36(41)38-29-17-11-8-12-18-29)32(26-15-9-7-10-16-26)35(39)27-19-21-28(37)22-20-27/h5-12,14-22,25,30H,1,13,23-24H2,2-4H3,(H,38,41)/t30-/m0/s1 |
| InChIKey | UINXLGJXOJFLBM-PMERELPUSA-N |
| XLogP | 8.79 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.70 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|