C33H37FN2O2 — CID 142950117
5-(4-fluorophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-(3-hydroxyhex-5-enyl)-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 142950117) has the molecular formula C33H37FN2O2 and a molecular weight of 512.67 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-(3-hydroxyhex-5-enyl)-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-(3-hydroxyhex-5-enyl)-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 142950117 |
| Molecular Formula | C33H37FN2O2 |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-(3-hydroxyhex-5-enyl)-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | C=CCC(O)CCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)N/C(C=C)=C/C=C\C)c1C(C)C |
| InChI | InChI=1S/C33H37FN2O2/c1-6-9-16-27(8-3)35-33(38)30-29(24-14-11-10-12-15-24)32(25-17-19-26(34)20-18-25)36(31(30)23(4)5)22-21-28(37)13-7-2/h6-12,14-20,23,28,37H,2-3,13,21-22H2,1,4-5H3,(H,35,38)/b9-6-,27-16+ |
| InChIKey | FDMAEHLUOYCUAB-XLKFVIAFSA-N |
| XLogP | 7.79 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|