C28H29FN2O2 — CID 142950085
5-(4-fluorophenyl)-1-(3-oxopropyl)-N-[(3E)-penta-1,3-dien-3-yl]-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 142950085) has the molecular formula C28H29FN2O2 and a molecular weight of 444.55 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-(3-oxopropyl)-N-[(3E)-penta-1,3-dien-3-yl]-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-1-(3-oxopropyl)-N-[(3E)-penta-1,3-dien-3-yl]-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 142950085 |
| Molecular Formula | C28H29FN2O2 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 5-(4-fluorophenyl)-1-(3-oxopropyl)-N-[(3E)-penta-1,3-dien-3-yl]-4-phenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | C=C/C(=C\C)NC(=O)c1c(-c2ccccc2)c(-c2ccc(F)cc2)n(CCC=O)c1C(C)C |
| InChI | InChI=1S/C28H29FN2O2/c1-5-23(6-2)30-28(33)25-24(20-11-8-7-9-12-20)27(21-13-15-22(29)16-14-21)31(17-10-18-32)26(25)19(3)4/h5-9,11-16,18-19H,1,10,17H2,2-4H3,(H,30,33)/b23-6+ |
| InChIKey | SEUMHAXRRFCGPV-TXNBCWFRSA-N |
| XLogP | 6.49 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|