C32H33FN2O2 — CID 58708289
5-(4-fluorophenyl)-1-[(3S)-3-hydroxyhex-5-enyl]-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide (PubChem CID 58708289) has the molecular formula C32H33FN2O2 and a molecular weight of 496.63 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-[(3S)-3-hydroxyhex-5-enyl]-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-1-[(3S)-3-hydroxyhex-5-enyl]-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58708289 |
| Molecular Formula | C32H33FN2O2 |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 5-(4-fluorophenyl)-1-[(3S)-3-hydroxyhex-5-enyl]-N,4-diphenyl-2-propan-2-ylpyrrole-3-carboxamide |
| SMILES | C=CC[C@H](O)CCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)Nc2ccccc2)c1C(C)C |
| InChI | InChI=1S/C32H33FN2O2/c1-4-11-27(36)20-21-35-30(22(2)3)29(32(37)34-26-14-9-6-10-15-26)28(23-12-7-5-8-13-23)31(35)24-16-18-25(33)19-17-24/h4-10,12-19,22,27,36H,1,11,20-21H2,2-3H3,(H,34,37)/t27-/m0/s1 |
| InChIKey | IBOYZKXVJAPSBZ-MHZLTWQESA-N |
| XLogP | 7.66 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|