C37H41FN2O4 — CID 151067737
tert-butyl (Z,5S)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxyhept-2-enoate (PubChem CID 151067737) has the molecular formula C37H41FN2O4 and a molecular weight of 596.74 g/mol. Its IUPAC name is tert-butyl (Z,5S)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxyhept-2-enoate.
| Compound Name | tert-butyl (Z,5S)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxyhept-2-enoate |
|---|---|
| PubChem CID | 151067737 |
| Molecular Formula | C37H41FN2O4 |
| Molecular Weight | 596.74 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | tert-butyl (Z,5S)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-5-hydroxyhept-2-enoate |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C/C=C\C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H41FN2O4/c1-25(2)34-33(36(43)39-29-15-10-7-11-16-29)32(26-13-8-6-9-14-26)35(27-19-21-28(38)22-20-27)40(34)24-23-30(41)17-12-18-31(42)44-37(3,4)5/h6-16,18-22,25,30,41H,17,23-24H2,1-5H3,(H,39,43)/b18-12-/t30-/m0/s1 |
| InChIKey | MHMDANZSUAPCME-ZDNHZHOCSA-N |
| XLogP | 8.38 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.74 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|