C18H16F2O2 — CID 163210308
ethyl (Z)-2,2-difluoro-4-(4-phenylphenyl)but-3-enoate (PubChem CID 163210308) has the molecular formula C18H16F2O2 and a molecular weight of 302.32 g/mol. Its IUPAC name is ethyl (Z)-2,2-difluoro-4-(4-phenylphenyl)but-3-enoate.
| Compound Name | ethyl (Z)-2,2-difluoro-4-(4-phenylphenyl)but-3-enoate |
|---|---|
| PubChem CID | 163210308 |
| Molecular Formula | C18H16F2O2 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | ethyl (Z)-2,2-difluoro-4-(4-phenylphenyl)but-3-enoate |
| SMILES | CCOC(=O)C(F)(F)/C=C\c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16F2O2/c1-2-22-17(21)18(19,20)13-12-14-8-10-16(11-9-14)15-6-4-3-5-7-15/h3-13H,2H2,1H3/b13-12- |
| InChIKey | GFXZUBKOIDTWNM-SEYXRHQNSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |