C16H19FO3 — CID 102471768
ethyl (E,2R,3R)-2-acetyl-2-fluoro-3-methyl-5-phenylpent-4-enoate (PubChem CID 102471768) has the molecular formula C16H19FO3 and a molecular weight of 278.32 g/mol. Its IUPAC name is ethyl (E,2R,3R)-2-acetyl-2-fluoro-3-methyl-5-phenylpent-4-enoate.
| Compound Name | ethyl (E,2R,3R)-2-acetyl-2-fluoro-3-methyl-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 102471768 |
| Molecular Formula | C16H19FO3 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | ethyl (E,2R,3R)-2-acetyl-2-fluoro-3-methyl-5-phenylpent-4-enoate |
| SMILES | CCOC(=O)[C@](F)(C(C)=O)[C@H](C)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H19FO3/c1-4-20-15(19)16(17,13(3)18)12(2)10-11-14-8-6-5-7-9-14/h5-12H,4H2,1-3H3/b11-10+/t12-,16-/m1/s1 |
| InChIKey | PVAVSFRYSOZQJI-WKPMEBPRSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|