C21H24O2 — CID 134973992
ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate (PubChem CID 134973992) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate.
| Compound Name | ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 134973992 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)[C@@H](C)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H24O2/c1-3-23-21(22)20(16-19-12-8-5-9-13-19)17(2)14-15-18-10-6-4-7-11-18/h4-15,17,20H,3,16H2,1-2H3/b15-14+/t17-,20+/m0/s1 |
| InChIKey | DNGAVOILCJPNQB-FBUJUEFYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |