ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate

C21H24O2 — CID 134973992

IUPACethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate
SMILESCCOC(=O)[C@H](Cc1ccccc1)[C@@H](C)/C=C/c1ccccc1
InChIInChI=1S/C21H24O2/c1-3-23-21(22)20(16-19-12-8-5-9-13-19)17(2)14-15-18-10-6-4-7-11-18/h4-15,17,20H,3,16H2,1-2H3/b15-14+/t17-,20+/m0/s1
InChIKeyDNGAVOILCJPNQB-FBUJUEFYSA-N
MW308.42 g/mol
LogP4.76
Rot. Bonds7

About ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate

ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate (PubChem CID 134973992) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate.

Molecular Properties

Compound Nameethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate
PubChem CID134973992
Molecular FormulaC21H24O2
Molecular Weight308.42 g/mol
Exact Mass308.18
IUPAC Nameethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate
SMILESCCOC(=O)[C@H](Cc1ccccc1)[C@@H](C)/C=C/c1ccccc1
InChIInChI=1S/C21H24O2/c1-3-23-21(22)20(16-19-12-8-5-9-13-19)17(2)14-15-18-10-6-4-7-11-18/h4-15,17,20H,3,16H2,1-2H3/b15-14+/t17-,20+/m0/s1
InChIKeyDNGAVOILCJPNQB-FBUJUEFYSA-N
XLogP4.76
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.42
LogP ≤ 54.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate?
The IUPAC name of ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate (CID 134973992) is ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate.
What is the SMILES notation for ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate?
The canonical SMILES for ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate is CCOC(=O)[C@H](Cc1ccccc1)[C@@H](C)/C=C/c1ccccc1.
What is the InChIKey of ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate?
The InChIKey is DNGAVOILCJPNQB-FBUJUEFYSA-N. The full InChI is InChI=1S/C21H24O2/c1-3-23-21(22)20(16-19-12-8-5-9-13-19)17(2)14-15-18-10-6-4-7-11-18/h4-15,17,20H,3,16H2,1-2H3/b15-14+/t17-,20+/m0/s1.
What are the key properties of ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate?
ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate has a molecular weight of 308.42 g/mol, XLogP of 4.76, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E,2R,3S)-2-benzyl-3-methyl-5-phenylpent-4-enoate is sourced from PubChem (CID 134973992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).