C28H30O4 — CID 72792063
ethyl 2-methyl-2-[4-[3-(4-phenylphenyl)prop-2-enoxy]phenoxy]butanoate (PubChem CID 72792063) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is ethyl 2-methyl-2-[4-[3-(4-phenylphenyl)prop-2-enoxy]phenoxy]butanoate.
| Compound Name | ethyl 2-methyl-2-[4-[3-(4-phenylphenyl)prop-2-enoxy]phenoxy]butanoate |
|---|---|
| PubChem CID | 72792063 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | ethyl 2-methyl-2-[4-[3-(4-phenylphenyl)prop-2-enoxy]phenoxy]butanoate |
| SMILES | CCOC(=O)C(C)(CC)Oc1ccc(OCC=Cc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H30O4/c1-4-28(3,27(29)30-5-2)32-26-19-17-25(18-20-26)31-21-9-10-22-13-15-24(16-14-22)23-11-7-6-8-12-23/h6-20H,4-5,21H2,1-3H3 |
| InChIKey | BBBFXJXMDLSVJM-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |