C22H26O7S — CID 58816032
ethyl 2-methyl-2-[4-[(E)-3-(4-methylsulfonyloxyphenyl)prop-2-enoxy]phenoxy]propanoate (PubChem CID 58816032) has the molecular formula C22H26O7S and a molecular weight of 434.51 g/mol. Its IUPAC name is ethyl 2-methyl-2-[4-[(E)-3-(4-methylsulfonyloxyphenyl)prop-2-enoxy]phenoxy]propanoate.
| Compound Name | ethyl 2-methyl-2-[4-[(E)-3-(4-methylsulfonyloxyphenyl)prop-2-enoxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 58816032 |
| Molecular Formula | C22H26O7S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | ethyl 2-methyl-2-[4-[(E)-3-(4-methylsulfonyloxyphenyl)prop-2-enoxy]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(OC/C=C/c2ccc(OS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H26O7S/c1-5-26-21(23)22(2,3)28-19-14-12-18(13-15-19)27-16-6-7-17-8-10-20(11-9-17)29-30(4,24)25/h6-15H,5,16H2,1-4H3/b7-6+ |
| InChIKey | UAFMIOXZRQKDMA-VOTSOKGWSA-N |
| XLogP | 3.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|