C21H20Cl2O4 — CID 54587554
ethyl 2-[4-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]phenoxy]-2-methylpropanoate (PubChem CID 54587554) has the molecular formula C21H20Cl2O4 and a molecular weight of 407.29 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 54587554 |
| Molecular Formula | C21H20Cl2O4 |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | ethyl 2-[4-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]phenoxy]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(C(=O)/C=C/c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H20Cl2O4/c1-4-26-20(25)21(2,3)27-18-8-6-15(7-9-18)19(24)10-5-14-11-16(22)13-17(23)12-14/h5-13H,4H2,1-3H3/b10-5+ |
| InChIKey | KUVQCHVCGRENTP-BJMVGYQFSA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|