C27H25ClO5 — CID 7324879
2-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenoxy]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate (PubChem CID 7324879) has the molecular formula C27H25ClO5 and a molecular weight of 464.95 g/mol. Its IUPAC name is 2-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenoxy]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate.
| Compound Name | 2-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenoxy]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|---|---|
| PubChem CID | 7324879 |
| Molecular Formula | C27H25ClO5 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-[4-[(Z)-3-oxo-3-phenylprop-1-enyl]phenoxy]ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCOc1ccc(/C=C\C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25ClO5/c1-27(2,33-24-15-11-22(28)12-16-24)26(30)32-19-18-31-23-13-8-20(9-14-23)10-17-25(29)21-6-4-3-5-7-21/h3-17H,18-19H2,1-2H3/b17-10- |
| InChIKey | BUZAOCGYKNRDTE-YVLHZVERSA-N |
| XLogP | 6.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|