C28H30O4 — CID 69474931
2-methyl-2-[4-[3-(4-phenylphenyl)but-2-enoxy]phenoxy]pentanoic acid (PubChem CID 69474931) has the molecular formula C28H30O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is 2-methyl-2-[4-[3-(4-phenylphenyl)but-2-enoxy]phenoxy]pentanoic acid.
| Compound Name | 2-methyl-2-[4-[3-(4-phenylphenyl)but-2-enoxy]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 69474931 |
| Molecular Formula | C28H30O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-methyl-2-[4-[3-(4-phenylphenyl)but-2-enoxy]phenoxy]pentanoic acid |
| SMILES | CCCC(C)(Oc1ccc(OCC=C(C)c2ccc(-c3ccccc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H30O4/c1-4-19-28(3,27(29)30)32-26-16-14-25(15-17-26)31-20-18-21(2)22-10-12-24(13-11-22)23-8-6-5-7-9-23/h5-18H,4,19-20H2,1-3H3,(H,29,30) |
| InChIKey | VIGJJGYCQBRZRA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |