C23H24N2O4 — CID 11383784
2-[4-[(Z)-3-(4-imidazol-1-ylphenyl)but-2-enoxy]phenoxy]-2-methylpropanoic acid (PubChem CID 11383784) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[4-[(Z)-3-(4-imidazol-1-ylphenyl)but-2-enoxy]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(Z)-3-(4-imidazol-1-ylphenyl)but-2-enoxy]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11383784 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[4-[(Z)-3-(4-imidazol-1-ylphenyl)but-2-enoxy]phenoxy]-2-methylpropanoic acid |
| SMILES | C/C(=C/COc1ccc(OC(C)(C)C(=O)O)cc1)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-17(18-4-6-19(7-5-18)25-14-13-24-16-25)12-15-28-20-8-10-21(11-9-20)29-23(2,3)22(26)27/h4-14,16H,15H2,1-3H3,(H,26,27)/b17-12- |
| InChIKey | WQBKMUFKVHQEBX-ATVHPVEESA-N |
| XLogP | 4.60 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |