C28H27FO4 — CID 143039224
(2S)-2-[4-[(E)-3-[4-(4-fluorophenyl)phenyl]but-2-enoxy]phenoxy]-2,3-dimethylbut-3-enoic acid (PubChem CID 143039224) has the molecular formula C28H27FO4 and a molecular weight of 446.52 g/mol. Its IUPAC name is (2S)-2-[4-[(E)-3-[4-(4-fluorophenyl)phenyl]but-2-enoxy]phenoxy]-2,3-dimethylbut-3-enoic acid.
| Compound Name | (2S)-2-[4-[(E)-3-[4-(4-fluorophenyl)phenyl]but-2-enoxy]phenoxy]-2,3-dimethylbut-3-enoic acid |
|---|---|
| PubChem CID | 143039224 |
| Molecular Formula | C28H27FO4 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2S)-2-[4-[(E)-3-[4-(4-fluorophenyl)phenyl]but-2-enoxy]phenoxy]-2,3-dimethylbut-3-enoic acid |
| SMILES | C=C(C)[C@](C)(Oc1ccc(OC/C=C(\C)c2ccc(-c3ccc(F)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H27FO4/c1-19(2)28(4,27(30)31)33-26-15-13-25(14-16-26)32-18-17-20(3)21-5-7-22(8-6-21)23-9-11-24(29)12-10-23/h5-17H,1,18H2,2-4H3,(H,30,31)/b20-17+/t28-/m0/s1 |
| InChIKey | ZZZYYRRDOHKNDQ-YJWXQWNFSA-N |
| XLogP | 6.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|