C21H24O4 — CID 70554359
2-[4-(2,3-dihydro-1H-inden-2-yloxy)phenoxy]-2-methylpentanoic acid (PubChem CID 70554359) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1H-inden-2-yloxy)phenoxy]-2-methylpentanoic acid.
| Compound Name | 2-[4-(2,3-dihydro-1H-inden-2-yloxy)phenoxy]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 70554359 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-[4-(2,3-dihydro-1H-inden-2-yloxy)phenoxy]-2-methylpentanoic acid |
| SMILES | CCCC(C)(Oc1ccc(OC2Cc3ccccc3C2)cc1)C(=O)O |
| InChI | InChI=1S/C21H24O4/c1-3-12-21(2,20(22)23)25-18-10-8-17(9-11-18)24-19-13-15-6-4-5-7-16(15)14-19/h4-11,19H,3,12-14H2,1-2H3,(H,22,23) |
| InChIKey | HDHYYLWWUBPLOF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |