C20H31NO3 — CID 133247059
N-(4-cyclopentyloxyphenyl)-2-methyl-2-propoxypentanamide (PubChem CID 133247059) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is N-(4-cyclopentyloxyphenyl)-2-methyl-2-propoxypentanamide.
| Compound Name | N-(4-cyclopentyloxyphenyl)-2-methyl-2-propoxypentanamide |
|---|---|
| PubChem CID | 133247059 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N-(4-cyclopentyloxyphenyl)-2-methyl-2-propoxypentanamide |
| SMILES | CCCOC(C)(CCC)C(=O)Nc1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C20H31NO3/c1-4-14-20(3,23-15-5-2)19(22)21-16-10-12-18(13-11-16)24-17-8-6-7-9-17/h10-13,17H,4-9,14-15H2,1-3H3,(H,21,22) |
| InChIKey | CUAFRTRTOVWSAM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |