C21H33NO3 — CID 133246722
N-(4-cyclopentyloxyphenyl)-2-ethoxy-2-methylheptanamide (PubChem CID 133246722) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is N-(4-cyclopentyloxyphenyl)-2-ethoxy-2-methylheptanamide.
| Compound Name | N-(4-cyclopentyloxyphenyl)-2-ethoxy-2-methylheptanamide |
|---|---|
| PubChem CID | 133246722 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | N-(4-cyclopentyloxyphenyl)-2-ethoxy-2-methylheptanamide |
| SMILES | CCCCCC(C)(OCC)C(=O)Nc1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C21H33NO3/c1-4-6-9-16-21(3,24-5-2)20(23)22-17-12-14-19(15-13-17)25-18-10-7-8-11-18/h12-15,18H,4-11,16H2,1-3H3,(H,22,23) |
| InChIKey | VTEDUNCVFXHIKP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|