C20H33NO4 — CID 100728845
(2S)-2-ethoxy-N-[4-(2-ethoxyethoxy)phenyl]-2-methylheptanamide (PubChem CID 100728845) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is (2S)-2-ethoxy-N-[4-(2-ethoxyethoxy)phenyl]-2-methylheptanamide.
| Compound Name | (2S)-2-ethoxy-N-[4-(2-ethoxyethoxy)phenyl]-2-methylheptanamide |
|---|---|
| PubChem CID | 100728845 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | (2S)-2-ethoxy-N-[4-(2-ethoxyethoxy)phenyl]-2-methylheptanamide |
| SMILES | CCCCC[C@](C)(OCC)C(=O)Nc1ccc(OCCOCC)cc1 |
| InChI | InChI=1S/C20H33NO4/c1-5-8-9-14-20(4,25-7-3)19(22)21-17-10-12-18(13-11-17)24-16-15-23-6-2/h10-13H,5-9,14-16H2,1-4H3,(H,21,22)/t20-/m0/s1 |
| InChIKey | BWUZYIFEJOLRQS-FQEVSTJZSA-N |
| XLogP | 4.42 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|