C17H26BrNO3 — CID 100726840
(2S)-N-[4-(2-bromoethoxy)phenyl]-2-ethoxy-2-methylhexanamide (PubChem CID 100726840) has the molecular formula C17H26BrNO3 and a molecular weight of 372.30 g/mol. Its IUPAC name is (2S)-N-[4-(2-bromoethoxy)phenyl]-2-ethoxy-2-methylhexanamide.
| Compound Name | (2S)-N-[4-(2-bromoethoxy)phenyl]-2-ethoxy-2-methylhexanamide |
|---|---|
| PubChem CID | 100726840 |
| Molecular Formula | C17H26BrNO3 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (2S)-N-[4-(2-bromoethoxy)phenyl]-2-ethoxy-2-methylhexanamide |
| SMILES | CCCC[C@](C)(OCC)C(=O)Nc1ccc(OCCBr)cc1 |
| InChI | InChI=1S/C17H26BrNO3/c1-4-6-11-17(3,22-5-2)16(20)19-14-7-9-15(10-8-14)21-13-12-18/h7-10H,4-6,11-13H2,1-3H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | SDNGPULOJARGFG-KRWDZBQOSA-N |
| XLogP | 4.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|