C15H22BrNO3 — CID 100697214
(2S)-N-[4-(2-bromoethoxy)phenyl]-2-methoxy-2-methylpentanamide (PubChem CID 100697214) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is (2S)-N-[4-(2-bromoethoxy)phenyl]-2-methoxy-2-methylpentanamide.
| Compound Name | (2S)-N-[4-(2-bromoethoxy)phenyl]-2-methoxy-2-methylpentanamide |
|---|---|
| PubChem CID | 100697214 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (2S)-N-[4-(2-bromoethoxy)phenyl]-2-methoxy-2-methylpentanamide |
| SMILES | CCC[C@](C)(OC)C(=O)Nc1ccc(OCCBr)cc1 |
| InChI | InChI=1S/C15H22BrNO3/c1-4-9-15(2,19-3)14(18)17-12-5-7-13(8-6-12)20-11-10-16/h5-8H,4,9-11H2,1-3H3,(H,17,18)/t15-/m0/s1 |
| InChIKey | GKHMFVGLZVNXSH-HNNXBMFYSA-N |
| XLogP | 3.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|