C19H32N2O3 — CID 133247067
N-[4-[2-(dimethylamino)ethoxy]phenyl]-2-methyl-2-propoxypentanamide (PubChem CID 133247067) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[4-[2-(dimethylamino)ethoxy]phenyl]-2-methyl-2-propoxypentanamide.
| Compound Name | N-[4-[2-(dimethylamino)ethoxy]phenyl]-2-methyl-2-propoxypentanamide |
|---|---|
| PubChem CID | 133247067 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | N-[4-[2-(dimethylamino)ethoxy]phenyl]-2-methyl-2-propoxypentanamide |
| SMILES | CCCOC(C)(CCC)C(=O)Nc1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O3/c1-6-12-19(3,24-14-7-2)18(22)20-16-8-10-17(11-9-16)23-15-13-21(4)5/h8-11H,6-7,12-15H2,1-5H3,(H,20,22) |
| InChIKey | UDLOLDIBPDCUFO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |